C21H34N2OS — CID 19872421
4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]-1-piperidin-1-ylbutane-1-thione (PubChem CID 19872421) has the molecular formula C21H34N2OS and a molecular weight of 362.58 g/mol. Its IUPAC name is 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]-1-piperidin-1-ylbutane-1-thione.
| Compound Name | 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]-1-piperidin-1-ylbutane-1-thione |
|---|---|
| PubChem CID | 19872421 |
| Molecular Formula | C21H34N2OS |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]-1-piperidin-1-ylbutane-1-thione |
| SMILES | CCN(CCCC(=S)N1CCCCC1)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H34N2OS/c1-4-22(16-8-9-21(25)23-14-6-5-7-15-23)18(2)17-19-10-12-20(24-3)13-11-19/h10-13,18H,4-9,14-17H2,1-3H3 |
| InChIKey | GEVHRNNYAALDKR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|