C27H37N3O3 — CID 19872439
1-(4-benzoylpiperazin-1-yl)-4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butan-1-one (PubChem CID 19872439) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butan-1-one.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butan-1-one |
|---|---|
| PubChem CID | 19872439 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butan-1-one |
| SMILES | CCN(CCCC(=O)N1CCN(C(=O)c2ccccc2)CC1)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H37N3O3/c1-4-28(22(2)21-23-12-14-25(33-3)15-13-23)16-8-11-26(31)29-17-19-30(20-18-29)27(32)24-9-6-5-7-10-24/h5-7,9-10,12-15,22H,4,8,11,16-21H2,1-3H3 |
| InChIKey | OWXJHHVXSHQHIT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |