C19H31NO3 — CID 54252796
propan-2-yl 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butanoate (PubChem CID 54252796) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is propan-2-yl 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butanoate.
| Compound Name | propan-2-yl 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 54252796 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | propan-2-yl 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butanoate |
| SMILES | CCN(CCCC(=O)OC(C)C)C(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H31NO3/c1-6-20(13-7-8-19(21)23-15(2)3)16(4)14-17-9-11-18(22-5)12-10-17/h9-12,15-16H,6-8,13-14H2,1-5H3 |
| InChIKey | QXYOKIXEWLPRGI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |