C19H32ClNO3 — CID 70613084
7-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]heptanoic acid;hydrochloride (PubChem CID 70613084) has the molecular formula C19H32ClNO3 and a molecular weight of 357.92 g/mol. Its IUPAC name is 7-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]heptanoic acid;hydrochloride.
| Compound Name | 7-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]heptanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70613084 |
| Molecular Formula | C19H32ClNO3 |
| Molecular Weight | 357.92 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 7-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]heptanoic acid;hydrochloride |
| SMILES | CCN(CCCCCCC(=O)O)C(C)Cc1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C19H31NO3.ClH/c1-4-20(14-8-6-5-7-9-19(21)22)16(2)15-17-10-12-18(23-3)13-11-17;/h10-13,16H,4-9,14-15H2,1-3H3,(H,21,22);1H |
| InChIKey | KQBXJCOQNUJVKU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|