C30H41N3O4 — CID 18637059
[4-[(2S)-2-[[4-[4-(dimethylcarbamoyl)piperidin-1-yl]-4-oxobutyl]-ethylamino]propyl]phenyl] benzoate (PubChem CID 18637059) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is [4-[(2S)-2-[[4-[4-(dimethylcarbamoyl)piperidin-1-yl]-4-oxobutyl]-ethylamino]propyl]phenyl] benzoate.
| Compound Name | [4-[(2S)-2-[[4-[4-(dimethylcarbamoyl)piperidin-1-yl]-4-oxobutyl]-ethylamino]propyl]phenyl] benzoate |
|---|---|
| PubChem CID | 18637059 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | [4-[(2S)-2-[[4-[4-(dimethylcarbamoyl)piperidin-1-yl]-4-oxobutyl]-ethylamino]propyl]phenyl] benzoate |
| SMILES | CCN(CCCC(=O)N1CCC(C(=O)N(C)C)CC1)[C@@H](C)Cc1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H41N3O4/c1-5-32(19-9-12-28(34)33-20-17-25(18-21-33)29(35)31(3)4)23(2)22-24-13-15-27(16-14-24)37-30(36)26-10-7-6-8-11-26/h6-8,10-11,13-16,23,25H,5,9,12,17-22H2,1-4H3/t23-/m0/s1 |
| InChIKey | ZSIKXTMKCPOQPI-QHCPKHFHSA-N |
| XLogP | 4.27 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|