C23H38N2O3S — CID 174389312
1-[4-[ethyl-[1-(4-methylsulfonylphenyl)propan-2-yl]amino]butyl]azepane-2-carbaldehyde (PubChem CID 174389312) has the molecular formula C23H38N2O3S and a molecular weight of 422.64 g/mol. Its IUPAC name is 1-[4-[ethyl-[1-(4-methylsulfonylphenyl)propan-2-yl]amino]butyl]azepane-2-carbaldehyde.
| Compound Name | 1-[4-[ethyl-[1-(4-methylsulfonylphenyl)propan-2-yl]amino]butyl]azepane-2-carbaldehyde |
|---|---|
| PubChem CID | 174389312 |
| Molecular Formula | C23H38N2O3S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 1-[4-[ethyl-[1-(4-methylsulfonylphenyl)propan-2-yl]amino]butyl]azepane-2-carbaldehyde |
| SMILES | CCN(CCCCN1CCCCCC1C=O)C(C)Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H38N2O3S/c1-4-24(15-8-9-17-25-16-7-5-6-10-22(25)19-26)20(2)18-21-11-13-23(14-12-21)29(3,27)28/h11-14,19-20,22H,4-10,15-18H2,1-3H3 |
| InChIKey | QUMOIPDRYUUTBD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|