C27H38N2O3S — CID 69223641
1-[4-[1-[3-(benzenesulfonyl)phenyl]propan-2-yl-ethylamino]butyl]azepan-2-one (PubChem CID 69223641) has the molecular formula C27H38N2O3S and a molecular weight of 470.68 g/mol. Its IUPAC name is 1-[4-[1-[3-(benzenesulfonyl)phenyl]propan-2-yl-ethylamino]butyl]azepan-2-one.
| Compound Name | 1-[4-[1-[3-(benzenesulfonyl)phenyl]propan-2-yl-ethylamino]butyl]azepan-2-one |
|---|---|
| PubChem CID | 69223641 |
| Molecular Formula | C27H38N2O3S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 1-[4-[1-[3-(benzenesulfonyl)phenyl]propan-2-yl-ethylamino]butyl]azepan-2-one |
| SMILES | CCN(CCCCN1CCCCCC1=O)C(C)Cc1cccc(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H38N2O3S/c1-3-28(18-10-11-20-29-19-9-5-8-17-27(29)30)23(2)21-24-13-12-16-26(22-24)33(31,32)25-14-6-4-7-15-25/h4,6-7,12-16,22-23H,3,5,8-11,17-21H2,1-2H3 |
| InChIKey | DYWRKZUEPLPUDF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|