C21H34N2O4S2 — CID 87975199
S-[1-[(4-butoxyphenyl)sulfonyl-(2-pyrrolidin-1-ylethyl)amino]propan-2-yl] ethanethioate (PubChem CID 87975199) has the molecular formula C21H34N2O4S2 and a molecular weight of 442.65 g/mol. Its IUPAC name is S-[1-[(4-butoxyphenyl)sulfonyl-(2-pyrrolidin-1-ylethyl)amino]propan-2-yl] ethanethioate.
| Compound Name | S-[1-[(4-butoxyphenyl)sulfonyl-(2-pyrrolidin-1-ylethyl)amino]propan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 87975199 |
| Molecular Formula | C21H34N2O4S2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | S-[1-[(4-butoxyphenyl)sulfonyl-(2-pyrrolidin-1-ylethyl)amino]propan-2-yl] ethanethioate |
| SMILES | CCCCOc1ccc(S(=O)(=O)N(CCN2CCCC2)CC(C)SC(C)=O)cc1 |
| InChI | InChI=1S/C21H34N2O4S2/c1-4-5-16-27-20-8-10-21(11-9-20)29(25,26)23(17-18(2)28-19(3)24)15-14-22-12-6-7-13-22/h8-11,18H,4-7,12-17H2,1-3H3 |
| InChIKey | XZXASCWRHBSOTC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|