C15H25NO5S — CID 87974894
N-[(2R)-1-hydroxypropan-2-yl]-N-methyl-4-pentylperoxybenzenesulfonamide (PubChem CID 87974894) has the molecular formula C15H25NO5S and a molecular weight of 331.43 g/mol. Its IUPAC name is N-[(2R)-1-hydroxypropan-2-yl]-N-methyl-4-pentylperoxybenzenesulfonamide.
| Compound Name | N-[(2R)-1-hydroxypropan-2-yl]-N-methyl-4-pentylperoxybenzenesulfonamide |
|---|---|
| PubChem CID | 87974894 |
| Molecular Formula | C15H25NO5S |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[(2R)-1-hydroxypropan-2-yl]-N-methyl-4-pentylperoxybenzenesulfonamide |
| SMILES | CCCCCOOc1ccc(S(=O)(=O)N(C)[C@H](C)CO)cc1 |
| InChI | InChI=1S/C15H25NO5S/c1-4-5-6-11-20-21-14-7-9-15(10-8-14)22(18,19)16(3)13(2)12-17/h7-10,13,17H,4-6,11-12H2,1-3H3/t13-/m1/s1 |
| InChIKey | VXJVKNJFKUITNG-CYBMUJFWSA-N |
| XLogP | 2.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|