C12H15ClN4O2S — CID 115989030
3-amino-4-chloro-N-[(1,3-dimethylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 115989030) has the molecular formula C12H15ClN4O2S and a molecular weight of 314.80 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[(1,3-dimethylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-4-chloro-N-[(1,3-dimethylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115989030 |
| Molecular Formula | C12H15ClN4O2S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 3-amino-4-chloro-N-[(1,3-dimethylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | Cc1nn(C)cc1CNS(=O)(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C12H15ClN4O2S/c1-8-9(7-17(2)16-8)6-15-20(18,19)10-3-4-11(13)12(14)5-10/h3-5,7,15H,6,14H2,1-2H3 |
| InChIKey | RIJROLPGQLQRIU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|