C15H17N3O2S — CID 115991510
N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-(4-hydroxybut-1-ynyl)thiophene-3-carboxamide (PubChem CID 115991510) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-(4-hydroxybut-1-ynyl)thiophene-3-carboxamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-(4-hydroxybut-1-ynyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 115991510 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-(4-hydroxybut-1-ynyl)thiophene-3-carboxamide |
| SMILES | Cc1nn(C)cc1CNC(=O)c1csc(C#CCCO)c1 |
| InChI | InChI=1S/C15H17N3O2S/c1-11-13(9-18(2)17-11)8-16-15(20)12-7-14(21-10-12)5-3-4-6-19/h7,9-10,19H,4,6,8H2,1-2H3,(H,16,20) |
| InChIKey | PVJLVEGKJGDHOS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|