C25H31BrN4O3S — CID 11599206
4-amino-3-[(4-bromophenoxy)methyl]-N-[4-(4-methoxypiperidin-1-yl)butyl]thieno[3,2-c]pyridine-7-carboxamide (PubChem CID 11599206) has the molecular formula C25H31BrN4O3S and a molecular weight of 547.52 g/mol. Its IUPAC name is 4-amino-3-[(4-bromophenoxy)methyl]-N-[4-(4-methoxypiperidin-1-yl)butyl]thieno[3,2-c]pyridine-7-carboxamide.
| Compound Name | 4-amino-3-[(4-bromophenoxy)methyl]-N-[4-(4-methoxypiperidin-1-yl)butyl]thieno[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 11599206 |
| Molecular Formula | C25H31BrN4O3S |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 4-amino-3-[(4-bromophenoxy)methyl]-N-[4-(4-methoxypiperidin-1-yl)butyl]thieno[3,2-c]pyridine-7-carboxamide |
| SMILES | COC1CCN(CCCCNC(=O)c2cnc(N)c3c(COc4ccc(Br)cc4)csc23)CC1 |
| InChI | InChI=1S/C25H31BrN4O3S/c1-32-19-8-12-30(13-9-19)11-3-2-10-28-25(31)21-14-29-24(27)22-17(16-34-23(21)22)15-33-20-6-4-18(26)5-7-20/h4-7,14,16,19H,2-3,8-13,15H2,1H3,(H2,27,29)(H,28,31) |
| InChIKey | KQPVCSLDJLLKII-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|