C23H27BrN4O3S — CID 11591687
4-amino-3-[(4-bromophenoxy)methyl]-N-[2-(2-pyrrolidin-1-ylethoxy)ethyl]thieno[3,2-c]pyridine-7-carboxamide (PubChem CID 11591687) has the molecular formula C23H27BrN4O3S and a molecular weight of 519.47 g/mol. Its IUPAC name is 4-amino-3-[(4-bromophenoxy)methyl]-N-[2-(2-pyrrolidin-1-ylethoxy)ethyl]thieno[3,2-c]pyridine-7-carboxamide.
| Compound Name | 4-amino-3-[(4-bromophenoxy)methyl]-N-[2-(2-pyrrolidin-1-ylethoxy)ethyl]thieno[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 11591687 |
| Molecular Formula | C23H27BrN4O3S |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 4-amino-3-[(4-bromophenoxy)methyl]-N-[2-(2-pyrrolidin-1-ylethoxy)ethyl]thieno[3,2-c]pyridine-7-carboxamide |
| SMILES | Nc1ncc(C(=O)NCCOCCN2CCCC2)c2scc(COc3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C23H27BrN4O3S/c24-17-3-5-18(6-4-17)31-14-16-15-32-21-19(13-27-22(25)20(16)21)23(29)26-7-11-30-12-10-28-8-1-2-9-28/h3-6,13,15H,1-2,7-12,14H2,(H2,25,27)(H,26,29) |
| InChIKey | RRVOYYABKPUINM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|