C11H14N2O6S — CID 115992108
methyl 3-[(2-amino-2-oxoethoxy)sulfamoylmethyl]benzoate (PubChem CID 115992108) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is methyl 3-[(2-amino-2-oxoethoxy)sulfamoylmethyl]benzoate.
| Compound Name | methyl 3-[(2-amino-2-oxoethoxy)sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 115992108 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | methyl 3-[(2-amino-2-oxoethoxy)sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1cccc(CS(=O)(=O)NOCC(N)=O)c1 |
| InChI | InChI=1S/C11H14N2O6S/c1-18-11(15)9-4-2-3-8(5-9)7-20(16,17)13-19-6-10(12)14/h2-5,13H,6-7H2,1H3,(H2,12,14) |
| InChIKey | IYDMDEDSSUVOBL-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|