C13H19N3O4S — CID 115993737
3-amino-N-(2,2-dimethylcyclopentyl)-2-nitrobenzenesulfonamide (PubChem CID 115993737) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-amino-N-(2,2-dimethylcyclopentyl)-2-nitrobenzenesulfonamide.
| Compound Name | 3-amino-N-(2,2-dimethylcyclopentyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115993737 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-amino-N-(2,2-dimethylcyclopentyl)-2-nitrobenzenesulfonamide |
| SMILES | CC1(C)CCCC1NS(=O)(=O)c1cccc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O4S/c1-13(2)8-4-7-11(13)15-21(19,20)10-6-3-5-9(14)12(10)16(17)18/h3,5-6,11,15H,4,7-8,14H2,1-2H3 |
| InChIKey | QLIREIHZUDUPDP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|