C29H31F5N4O3 — CID 11599531
N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-1-oxo-3-phenyl-2,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 11599531) has the molecular formula C29H31F5N4O3 and a molecular weight of 578.58 g/mol. Its IUPAC name is N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-1-oxo-3-phenyl-2,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-1-oxo-3-phenyl-2,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 11599531 |
| Molecular Formula | C29H31F5N4O3 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-1-oxo-3-phenyl-2,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@@H](c2cccc(F)c2F)CN(CC(F)(F)F)C1=O)N1CCC2(CC1)CC(c1ccccc1)NC2=O |
| InChI | InChI=1S/C29H31F5N4O3/c30-21-8-4-7-20(24(21)31)19-9-10-22(25(39)38(16-19)17-29(32,33)34)36-27(41)37-13-11-28(12-14-37)15-23(35-26(28)40)18-5-2-1-3-6-18/h1-8,19,22-23H,9-17H2,(H,35,40)(H,36,41)/t19-,22-,23?/m1/s1 |
| InChIKey | WUJIDDIKIOHUSX-YNDSPKASSA-N |
| XLogP | 4.65 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |