C18H30N2O — CID 115999128
N-[1-(aminomethyl)-3,3,5,5-tetramethylcyclohexyl]-4-methoxyaniline (PubChem CID 115999128) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[1-(aminomethyl)-3,3,5,5-tetramethylcyclohexyl]-4-methoxyaniline.
| Compound Name | N-[1-(aminomethyl)-3,3,5,5-tetramethylcyclohexyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 115999128 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-[1-(aminomethyl)-3,3,5,5-tetramethylcyclohexyl]-4-methoxyaniline |
| SMILES | COc1ccc(NC2(CN)CC(C)(C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H30N2O/c1-16(2)10-17(3,4)12-18(11-16,13-19)20-14-6-8-15(21-5)9-7-14/h6-9,20H,10-13,19H2,1-5H3 |
| InChIKey | RDGFNRXUZXRMLZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|