About 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine
3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine (PubChem CID 79947900) has the molecular formula C15H24N2OS
and a molecular weight of 280.44 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine |
| PubChem CID | 79947900 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine |
| SMILES | COc1ccc(NC2(CN)CSCCC2(C)C)cc1 |
| InChI | InChI=1S/C15H24N2OS/c1-14(2)8-9-19-11-15(14,10-16)17-12-4-6-13(18-3)7-5-12/h4-7,17H,8-11,16H2,1-3H3 |
| InChIKey | PXHZXPHZBFPZKQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine?
The IUPAC name of 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine (CID 79947900) is 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine.
What is the SMILES notation for 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine?
The canonical SMILES for 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine is COc1ccc(NC2(CN)CSCCC2(C)C)cc1.
What is the InChIKey of 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine?
The InChIKey is PXHZXPHZBFPZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2OS/c1-14(2)8-9-19-11-15(14,10-16)17-12-4-6-13(18-3)7-5-12/h4-7,17H,8-11,16H2,1-3H3.
What are the key properties of 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine?
3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine has a molecular weight of 280.44 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N-(4-methoxyphenyl)-4,4-dimethylthian-3-amine is sourced from PubChem (CID 79947900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).