C20H11N5 — CID 11602200
3-(1H-phenanthro[9,10-d]imidazol-2-yl)pyrazine-2-carbonitrile (PubChem CID 11602200) has the molecular formula C20H11N5 and a molecular weight of 321.34 g/mol. Its IUPAC name is 3-(1H-phenanthro[9,10-d]imidazol-2-yl)pyrazine-2-carbonitrile.
| Compound Name | 3-(1H-phenanthro[9,10-d]imidazol-2-yl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 11602200 |
| Molecular Formula | C20H11N5 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-(1H-phenanthro[9,10-d]imidazol-2-yl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1-c1nc2c3ccccc3c3ccccc3c2[nH]1 |
| InChI | InChI=1S/C20H11N5/c21-11-16-19(23-10-9-22-16)20-24-17-14-7-3-1-5-12(14)13-6-2-4-8-15(13)18(17)25-20/h1-10H,(H,24,25) |
| InChIKey | SIFMRIDDGJWLJN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|