C21H18N2O5 — CID 11603276
N-[3-[(E)-3-(2,4-dioxo-1H-quinolin-3-yl)-3-oxoprop-1-enyl]phenyl]-2-methoxyacetamide (PubChem CID 11603276) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[3-[(E)-3-(2,4-dioxo-1H-quinolin-3-yl)-3-oxoprop-1-enyl]phenyl]-2-methoxyacetamide.
| Compound Name | N-[3-[(E)-3-(2,4-dioxo-1H-quinolin-3-yl)-3-oxoprop-1-enyl]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 11603276 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[3-[(E)-3-(2,4-dioxo-1H-quinolin-3-yl)-3-oxoprop-1-enyl]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cccc(/C=C/C(=O)C2C(=O)Nc3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H18N2O5/c1-28-12-18(25)22-14-6-4-5-13(11-14)9-10-17(24)19-20(26)15-7-2-3-8-16(15)23-21(19)27/h2-11,19H,12H2,1H3,(H,22,25)(H,23,27)/b10-9+ |
| InChIKey | QCMCEIHPKGIQPU-MDZDMXLPSA-N |
| XLogP | 2.31 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|