C21H20N2O6S — CID 91539399
2-methoxy-N-[3-[3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]phenyl]acetamide (PubChem CID 91539399) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-methoxy-N-[3-[3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[3-[3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 91539399 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-methoxy-N-[3-[3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1cccc(C=CC(=O)C2C(=O)c3ccccc3S(=O)(=O)N2C)c1 |
| InChI | InChI=1S/C21H20N2O6S/c1-23-20(21(26)16-8-3-4-9-18(16)30(23,27)28)17(24)11-10-14-6-5-7-15(12-14)22-19(25)13-29-2/h3-12,20H,13H2,1-2H3,(H,22,25) |
| InChIKey | TZOSKEIPIBNCAP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|