C26H26N2O5 — CID 23131884
2-methoxy-N-[3-[(E)-3-oxo-3-(2-oxo-4-piperidin-1-ylchromen-3-yl)prop-1-enyl]phenyl]acetamide (PubChem CID 23131884) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-methoxy-N-[3-[(E)-3-oxo-3-(2-oxo-4-piperidin-1-ylchromen-3-yl)prop-1-enyl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[3-[(E)-3-oxo-3-(2-oxo-4-piperidin-1-ylchromen-3-yl)prop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23131884 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-methoxy-N-[3-[(E)-3-oxo-3-(2-oxo-4-piperidin-1-ylchromen-3-yl)prop-1-enyl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1cccc(/C=C/C(=O)c2c(N3CCCCC3)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C26H26N2O5/c1-32-17-23(30)27-19-9-7-8-18(16-19)12-13-21(29)24-25(28-14-5-2-6-15-28)20-10-3-4-11-22(20)33-26(24)31/h3-4,7-13,16H,2,5-6,14-15,17H2,1H3,(H,27,30)/b13-12+ |
| InChIKey | NEAKLVKAGMYPNL-OUKQBFOZSA-N |
| XLogP | 4.26 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|