C20H28ClN3O3 — CID 24832216
2-(diethylamino)-N-(2-oxo-4-piperidin-1-ylchromen-3-yl)acetamide;hydrochloride (PubChem CID 24832216) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2-oxo-4-piperidin-1-ylchromen-3-yl)acetamide;hydrochloride.
| Compound Name | 2-(diethylamino)-N-(2-oxo-4-piperidin-1-ylchromen-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 24832216 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-(diethylamino)-N-(2-oxo-4-piperidin-1-ylchromen-3-yl)acetamide;hydrochloride |
| SMILES | CCN(CC)CC(=O)Nc1c(N2CCCCC2)c2ccccc2oc1=O.Cl |
| InChI | InChI=1S/C20H27N3O3.ClH/c1-3-22(4-2)14-17(24)21-18-19(23-12-8-5-9-13-23)15-10-6-7-11-16(15)26-20(18)25;/h6-7,10-11H,3-5,8-9,12-14H2,1-2H3,(H,21,24);1H |
| InChIKey | CUKVDAUOEGSLNA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|