C21H22N2O4S — CID 50778716
2,5-dimethyl-N-(2-oxo-4-pyrrolidin-1-ylchromen-3-yl)benzenesulfonamide (PubChem CID 50778716) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2,5-dimethyl-N-(2-oxo-4-pyrrolidin-1-ylchromen-3-yl)benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-(2-oxo-4-pyrrolidin-1-ylchromen-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 50778716 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2,5-dimethyl-N-(2-oxo-4-pyrrolidin-1-ylchromen-3-yl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2c(N3CCCC3)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C21H22N2O4S/c1-14-9-10-15(2)18(13-14)28(25,26)22-19-20(23-11-5-6-12-23)16-7-3-4-8-17(16)27-21(19)24/h3-4,7-10,13,22H,5-6,11-12H2,1-2H3 |
| InChIKey | JHYWEPFDRGBSHM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|