C19H16N4O3S2 — CID 11603983
1-(1H-indol-2-ylsulfonyl)-3-(2-methyl-4-phenyl-1,3-thiazol-5-yl)urea (PubChem CID 11603983) has the molecular formula C19H16N4O3S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 1-(1H-indol-2-ylsulfonyl)-3-(2-methyl-4-phenyl-1,3-thiazol-5-yl)urea.
| Compound Name | 1-(1H-indol-2-ylsulfonyl)-3-(2-methyl-4-phenyl-1,3-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 11603983 |
| Molecular Formula | C19H16N4O3S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 1-(1H-indol-2-ylsulfonyl)-3-(2-methyl-4-phenyl-1,3-thiazol-5-yl)urea |
| SMILES | Cc1nc(-c2ccccc2)c(NC(=O)NS(=O)(=O)c2cc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C19H16N4O3S2/c1-12-20-17(13-7-3-2-4-8-13)18(27-12)22-19(24)23-28(25,26)16-11-14-9-5-6-10-15(14)21-16/h2-11,21H,1H3,(H2,22,23,24) |
| InChIKey | PMSAUPCYNJUJPX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |