C24H22N4O3 — CID 11604030
3-[5-(benzylcarbamoylamino)benzimidazol-1-yl]-3-phenylpropanoic acid (PubChem CID 11604030) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-[5-(benzylcarbamoylamino)benzimidazol-1-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[5-(benzylcarbamoylamino)benzimidazol-1-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11604030 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-[5-(benzylcarbamoylamino)benzimidazol-1-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(c1ccccc1)n1cnc2cc(NC(=O)NCc3ccccc3)ccc21 |
| InChI | InChI=1S/C24H22N4O3/c29-23(30)14-22(18-9-5-2-6-10-18)28-16-26-20-13-19(11-12-21(20)28)27-24(31)25-15-17-7-3-1-4-8-17/h1-13,16,22H,14-15H2,(H,29,30)(H2,25,27,31) |
| InChIKey | BSAIVCRPIXGLIA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |