C25H23N3O4 — CID 67353897
3-[5-[[2-(4-methoxyphenyl)acetyl]amino]benzimidazol-1-yl]-3-phenylpropanoic acid (PubChem CID 67353897) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-[5-[[2-(4-methoxyphenyl)acetyl]amino]benzimidazol-1-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[5-[[2-(4-methoxyphenyl)acetyl]amino]benzimidazol-1-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67353897 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-[5-[[2-(4-methoxyphenyl)acetyl]amino]benzimidazol-1-yl]-3-phenylpropanoic acid |
| SMILES | COc1ccc(CC(=O)Nc2ccc3c(c2)ncn3C(CC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O4/c1-32-20-10-7-17(8-11-20)13-24(29)27-19-9-12-22-21(14-19)26-16-28(22)23(15-25(30)31)18-5-3-2-4-6-18/h2-12,14,16,23H,13,15H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | JIUXMYWZPJMTBV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |