C29H26OSi — CID 11604120
tert-butyl-diphenyl-(7-phenylhepta-2,4,6-triynoxy)silane (PubChem CID 11604120) has the molecular formula C29H26OSi and a molecular weight of 418.61 g/mol. Its IUPAC name is tert-butyl-diphenyl-(7-phenylhepta-2,4,6-triynoxy)silane.
| Compound Name | tert-butyl-diphenyl-(7-phenylhepta-2,4,6-triynoxy)silane |
|---|---|
| PubChem CID | 11604120 |
| Molecular Formula | C29H26OSi |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | tert-butyl-diphenyl-(7-phenylhepta-2,4,6-triynoxy)silane |
| SMILES | CC(C)(C)[Si](OCC#CC#CC#Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26OSi/c1-29(2,3)31(27-21-13-8-14-22-27,28-23-15-9-16-24-28)30-25-17-6-4-5-10-18-26-19-11-7-12-20-26/h7-9,11-16,19-24H,25H2,1-3H3 |
| InChIKey | ZWUCWGYAKDUVLH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|