C19H19Cl3N2O2S2 — CID 11605361
N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2,3,4-trichlorobenzenesulfonamide (PubChem CID 11605361) has the molecular formula C19H19Cl3N2O2S2 and a molecular weight of 477.87 g/mol. Its IUPAC name is N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2,3,4-trichlorobenzenesulfonamide.
| Compound Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2,3,4-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 11605361 |
| Molecular Formula | C19H19Cl3N2O2S2 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2,3,4-trichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C19H19Cl3N2O2S2/c20-13-1-2-14(17(22)16(13)21)28(25,26)24-18-23-15(9-27-18)19-6-10-3-11(7-19)5-12(4-10)8-19/h1-2,9-12H,3-8H2,(H,23,24) |
| InChIKey | UKFFNFOOERMBDX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|