C25H45ClO4Si2 — CID 11605764
tert-butyl-[(1R,2Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-(4,4-diethoxybut-2-ynylidene)cyclopent-3-en-1-yl]oxy-dimethylsilane (PubChem CID 11605764) has the molecular formula C25H45ClO4Si2 and a molecular weight of 501.26 g/mol. Its IUPAC name is tert-butyl-[(1R,2Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-(4,4-diethoxybut-2-ynylidene)cyclopent-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-(4,4-diethoxybut-2-ynylidene)cyclopent-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11605764 |
| Molecular Formula | C25H45ClO4Si2 |
| Molecular Weight | 501.26 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | tert-butyl-[(1R,2Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-(4,4-diethoxybut-2-ynylidene)cyclopent-3-en-1-yl]oxy-dimethylsilane |
| SMILES | CCOC(C#C/C=C1\C(Cl)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C25H45ClO4Si2/c1-13-27-22(28-14-2)17-15-16-19-20(26)18-21(29-31(9,10)24(3,4)5)23(19)30-32(11,12)25(6,7)8/h16,18,21-23H,13-14H2,1-12H3/b19-16+/t21-,23-/m1/s1 |
| InChIKey | VZSZKRIHQJEVEW-BLQJKXSGSA-N |
| XLogP | 7.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.26 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|