C20H35ClO2Si2 — CID 11589381
tert-butyl-[(1R,2Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-prop-2-ynylidenecyclopent-3-en-1-yl]oxy-dimethylsilane (PubChem CID 11589381) has the molecular formula C20H35ClO2Si2 and a molecular weight of 399.12 g/mol. Its IUPAC name is tert-butyl-[(1R,2Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-prop-2-ynylidenecyclopent-3-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-prop-2-ynylidenecyclopent-3-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11589381 |
| Molecular Formula | C20H35ClO2Si2 |
| Molecular Weight | 399.12 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | tert-butyl-[(1R,2Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-chloro-2-prop-2-ynylidenecyclopent-3-en-1-yl]oxy-dimethylsilane |
| SMILES | C#C/C=C1\C(Cl)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H35ClO2Si2/c1-12-13-15-16(21)14-17(22-24(8,9)19(2,3)4)18(15)23-25(10,11)20(5,6)7/h1,13-14,17-18H,2-11H3/b15-13+/t17-,18-/m1/s1 |
| InChIKey | NUQUYDGCCFFWGC-ZWOQHNGQSA-N |
| XLogP | 6.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.12 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|