C25H44O2Si3 — CID 11496309
2-[(3R,4R,5E)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-ynylidenecyclopenten-1-yl]ethynyl-trimethylsilane (PubChem CID 11496309) has the molecular formula C25H44O2Si3 and a molecular weight of 460.88 g/mol. Its IUPAC name is 2-[(3R,4R,5E)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-ynylidenecyclopenten-1-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(3R,4R,5E)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-ynylidenecyclopenten-1-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11496309 |
| Molecular Formula | C25H44O2Si3 |
| Molecular Weight | 460.88 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-[(3R,4R,5E)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-ynylidenecyclopenten-1-yl]ethynyl-trimethylsilane |
| SMILES | C#C/C=C1\C(C#C[Si](C)(C)C)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O2Si3/c1-15-16-21-20(17-18-28(8,9)10)19-22(26-29(11,12)24(2,3)4)23(21)27-30(13,14)25(5,6)7/h1,16,19,22-23H,2-14H3/b21-16+/t22-,23-/m1/s1 |
| InChIKey | WSHZMTPPEZCZKP-PWECSXFSSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.88 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|