C28H56O2Si3 — CID 58982217
[(3E,5Z,7S,8S)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]trideca-3,5-dien-1-ynyl]-trimethylsilane (PubChem CID 58982217) has the molecular formula C28H56O2Si3 and a molecular weight of 509.01 g/mol. Its IUPAC name is [(3E,5Z,7S,8S)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]trideca-3,5-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(3E,5Z,7S,8S)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]trideca-3,5-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 58982217 |
| Molecular Formula | C28H56O2Si3 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | [(3E,5Z,7S,8S)-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]trideca-3,5-dien-1-ynyl]-trimethylsilane |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C\C=C\C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O2Si3/c1-15-16-19-22-25(29-32(11,12)27(2,3)4)26(30-33(13,14)28(5,6)7)23-20-17-18-21-24-31(8,9)10/h17-18,20,23,25-26H,15-16,19,22H2,1-14H3/b18-17+,23-20-/t25-,26-/m0/s1 |
| InChIKey | VQUHIZRBUHTDQC-DHURLNCBSA-N |
| XLogP | 9.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|