C32H66O3Si3 — CID 138984958
[(2S,3R,6E,8E,10E)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6,10-dimethyldodeca-6,8,10-trienoxy]-tert-butyl-dimethylsilane (PubChem CID 138984958) has the molecular formula C32H66O3Si3 and a molecular weight of 583.14 g/mol. Its IUPAC name is [(2S,3R,6E,8E,10E)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6,10-dimethyldodeca-6,8,10-trienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R,6E,8E,10E)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6,10-dimethyldodeca-6,8,10-trienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 138984958 |
| Molecular Formula | C32H66O3Si3 |
| Molecular Weight | 583.14 g/mol |
| Exact Mass | 582.43 |
| IUPAC Name | [(2S,3R,6E,8E,10E)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-6,10-dimethyldodeca-6,8,10-trienoxy]-tert-butyl-dimethylsilane |
| SMILES | C/C=C(C)/C=C/C=C(\C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H66O3Si3/c1-19-26(2)21-20-22-27(3)23-24-28(34-37(15,16)31(7,8)9)29(35-38(17,18)32(10,11)12)25-33-36(13,14)30(4,5)6/h19-22,28-29H,23-25H2,1-18H3/b21-20+,26-19+,27-22+/t28-,29+/m1/s1 |
| InChIKey | WNXNTRZEWDXFOL-REMSVTBNSA-N |
| XLogP | 11.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.14 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|