C25H52O2Si2 — CID 135022884
tert-butyl-[(E)-11-[tert-butyl(dimethyl)silyl]oxy-5-methyl-7-methylideneundec-5-enoxy]-dimethylsilane (PubChem CID 135022884) has the molecular formula C25H52O2Si2 and a molecular weight of 440.86 g/mol. Its IUPAC name is tert-butyl-[(E)-11-[tert-butyl(dimethyl)silyl]oxy-5-methyl-7-methylideneundec-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-11-[tert-butyl(dimethyl)silyl]oxy-5-methyl-7-methylideneundec-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135022884 |
| Molecular Formula | C25H52O2Si2 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | tert-butyl-[(E)-11-[tert-butyl(dimethyl)silyl]oxy-5-methyl-7-methylideneundec-5-enoxy]-dimethylsilane |
| SMILES | C=C(/C=C(\C)CCCCO[Si](C)(C)C(C)(C)C)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O2Si2/c1-22(17-13-15-19-26-28(9,10)24(3,4)5)21-23(2)18-14-16-20-27-29(11,12)25(6,7)8/h21H,1,13-20H2,2-12H3/b23-21+ |
| InChIKey | IZSMEROWGOWJMD-XTQSDGFTSA-N |
| XLogP | 8.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|