C22H40OSi — CID 134979902
tert-butyl-[(7E,9Z,11E,13E)-hexadeca-7,9,11,13-tetraenoxy]-dimethylsilane (PubChem CID 134979902) has the molecular formula C22H40OSi and a molecular weight of 348.65 g/mol. Its IUPAC name is tert-butyl-[(7E,9Z,11E,13E)-hexadeca-7,9,11,13-tetraenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(7E,9Z,11E,13E)-hexadeca-7,9,11,13-tetraenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134979902 |
| Molecular Formula | C22H40OSi |
| Molecular Weight | 348.65 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | tert-butyl-[(7E,9Z,11E,13E)-hexadeca-7,9,11,13-tetraenoxy]-dimethylsilane |
| SMILES | CC/C=C/C=C/C=C\C=C\CCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40OSi/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(5,6)22(2,3)4/h8-15H,7,16-21H2,1-6H3/b9-8+,11-10+,13-12-,15-14+ |
| InChIKey | QYLWYEAFZWNRJU-NJJTTXNHSA-N |
| XLogP | 7.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|