C33H42BrNO2 — CID 11606546
[1-[2-[(4-tert-butylphenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide (PubChem CID 11606546) has the molecular formula C33H42BrNO2 and a molecular weight of 564.61 g/mol. Its IUPAC name is [1-[2-[(4-tert-butylphenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide.
| Compound Name | [1-[2-[(4-tert-butylphenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide |
|---|---|
| PubChem CID | 11606546 |
| Molecular Formula | C33H42BrNO2 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | [1-[2-[(4-tert-butylphenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide |
| SMILES | CC(C)(C)c1ccc(COCC[N+]23CCC(C(O)(c4ccccc4)c4ccccc4)(CC2)CC3)cc1.[Br-] |
| InChI | InChI=1S/C33H42NO2.BrH/c1-31(2,3)28-16-14-27(15-17-28)26-36-25-24-34-21-18-32(19-22-34,20-23-34)33(35,29-10-6-4-7-11-29)30-12-8-5-9-13-30;/h4-17,35H,18-26H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | COGWXDUNGZOYBW-UHFFFAOYSA-M |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|