C45H64N6O4 — CID 11607380
methyl (2S)-2,6-bis[[4-[2-(11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl)ethyl]cyclohexyl]carbamoylamino]hexanoate (PubChem CID 11607380) has the molecular formula C45H64N6O4 and a molecular weight of 753.04 g/mol. Its IUPAC name is methyl (2S)-2,6-bis[[4-[2-(11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl)ethyl]cyclohexyl]carbamoylamino]hexanoate.
| Compound Name | methyl (2S)-2,6-bis[[4-[2-(11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl)ethyl]cyclohexyl]carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 11607380 |
| Molecular Formula | C45H64N6O4 |
| Molecular Weight | 753.04 g/mol |
| Exact Mass | 752.50 |
| IUPAC Name | methyl (2S)-2,6-bis[[4-[2-(11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-yl)ethyl]cyclohexyl]carbamoylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)NC1CCC(CCN2C3CCC2c2ccccc23)CC1)NC(=O)NC1CCC(CCN2C3CCC2c2ccccc23)CC1 |
| InChI | InChI=1S/C45H64N6O4/c1-55-43(52)38(49-45(54)48-33-19-15-31(16-20-33)26-29-51-41-23-24-42(51)37-11-5-4-10-36(37)41)12-6-7-27-46-44(53)47-32-17-13-30(14-18-32)25-28-50-39-21-22-40(50)35-9-3-2-8-34(35)39/h2-5,8-11,30-33,38-42H,6-7,12-29H2,1H3,(H2,46,47,53)(H2,48,49,54)/t30?,31?,32?,33?,38-,39?,40?,41?,42?/m0/s1 |
| InChIKey | DLGYPFMEQOYEPX-SECGALIFSA-N |
| XLogP | 7.98 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.04 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|