C7H8N2S2 — CID 11608044
1-prop-2-enylpyrimidine-2,4-dithione (PubChem CID 11608044) has the molecular formula C7H8N2S2 and a molecular weight of 184.29 g/mol. Its IUPAC name is 1-prop-2-enylpyrimidine-2,4-dithione.
| Compound Name | 1-prop-2-enylpyrimidine-2,4-dithione |
|---|---|
| PubChem CID | 11608044 |
| Molecular Formula | C7H8N2S2 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 1-prop-2-enylpyrimidine-2,4-dithione |
| SMILES | C=CCn1ccc(=S)[nH]c1=S |
| InChI | InChI=1S/C7H8N2S2/c1-2-4-9-5-3-6(10)8-7(9)11/h2-3,5H,1,4H2,(H,8,10,11) |
| InChIKey | QJCJEPXPYGSCKK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|