C15H15NO2 — CID 11608421
ethyl 1-methyl-4H-pyrrolo[1,2-a]indole-6-carboxylate (PubChem CID 11608421) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is ethyl 1-methyl-4H-pyrrolo[1,2-a]indole-6-carboxylate.
| Compound Name | ethyl 1-methyl-4H-pyrrolo[1,2-a]indole-6-carboxylate |
|---|---|
| PubChem CID | 11608421 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethyl 1-methyl-4H-pyrrolo[1,2-a]indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)Cc1ccc(C)n1-2 |
| InChI | InChI=1S/C15H15NO2/c1-3-18-15(17)11-5-7-14-12(8-11)9-13-6-4-10(2)16(13)14/h4-8H,3,9H2,1-2H3 |
| InChIKey | JDBPBAQSNASTFE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|