C16H20N2O2 — CID 11608760
methyl 5-methyl-2-propyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate (PubChem CID 11608760) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is methyl 5-methyl-2-propyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate.
| Compound Name | methyl 5-methyl-2-propyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11608760 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | methyl 5-methyl-2-propyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate |
| SMILES | CCCc1c(C(=O)OC)cc(C)n1Cc1ccccn1 |
| InChI | InChI=1S/C16H20N2O2/c1-4-7-15-14(16(19)20-3)10-12(2)18(15)11-13-8-5-6-9-17-13/h5-6,8-10H,4,7,11H2,1-3H3 |
| InChIKey | CPYZORFUOBDQMW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |