About 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate
3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate (PubChem CID 78863541) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate |
| PubChem CID | 78863541 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCCC(C)C)c(C)n1Cc1ccccn1 |
| InChI | InChI=1S/C18H24N2O2/c1-13(2)8-10-22-18(21)17-11-14(3)20(15(17)4)12-16-7-5-6-9-19-16/h5-7,9,11,13H,8,10,12H2,1-4H3 |
| InChIKey | CDAZIUNLRIXCOK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate?
The IUPAC name of 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate (CID 78863541) is 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate.
What is the SMILES notation for 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate?
The canonical SMILES for 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate is Cc1cc(C(=O)OCCC(C)C)c(C)n1Cc1ccccn1.
What is the InChIKey of 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate?
The InChIKey is CDAZIUNLRIXCOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2/c1-13(2)8-10-22-18(21)17-11-14(3)20(15(17)4)12-16-7-5-6-9-19-16/h5-7,9,11,13H,8,10,12H2,1-4H3.
What are the key properties of 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate?
3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate has a molecular weight of 300.40 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 2,5-dimethyl-1-(pyridin-2-ylmethyl)pyrrole-3-carboxylate is sourced from PubChem (CID 78863541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).