C18H24N2O2 — CID 11609124
ethyl 2-[(2R,3S,4S)-1-benzyl-2-cyano-4-propan-2-ylazetidin-3-yl]acetate (PubChem CID 11609124) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl 2-[(2R,3S,4S)-1-benzyl-2-cyano-4-propan-2-ylazetidin-3-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S,4S)-1-benzyl-2-cyano-4-propan-2-ylazetidin-3-yl]acetate |
|---|---|
| PubChem CID | 11609124 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | ethyl 2-[(2R,3S,4S)-1-benzyl-2-cyano-4-propan-2-ylazetidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@H](C#N)N(Cc2ccccc2)[C@H]1C(C)C |
| InChI | InChI=1S/C18H24N2O2/c1-4-22-17(21)10-15-16(11-19)20(18(15)13(2)3)12-14-8-6-5-7-9-14/h5-9,13,15-16,18H,4,10,12H2,1-3H3/t15-,16+,18+/m1/s1 |
| InChIKey | YREDWIZBWKCYBJ-RYRKJORJSA-N |
| XLogP | 2.99 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |