C20H28O3 — CID 11609382
(2R,3R,3aS,4R,6S,6aS)-3-butyl-4,6-bis(hydroxymethyl)-2-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one (PubChem CID 11609382) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2R,3R,3aS,4R,6S,6aS)-3-butyl-4,6-bis(hydroxymethyl)-2-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one.
| Compound Name | (2R,3R,3aS,4R,6S,6aS)-3-butyl-4,6-bis(hydroxymethyl)-2-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 11609382 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (2R,3R,3aS,4R,6S,6aS)-3-butyl-4,6-bis(hydroxymethyl)-2-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
| SMILES | CCCC[C@@H]1[C@H]2[C@H](CO)C[C@H](CO)[C@H]2C(=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H28O3/c1-2-3-9-16-17-14(11-21)10-15(12-22)19(17)20(23)18(16)13-7-5-4-6-8-13/h4-8,14-19,21-22H,2-3,9-12H2,1H3/t14-,15+,16+,17+,18-,19+/m0/s1 |
| InChIKey | OYIPJQUUOPOXCF-QZIZDEJHSA-N |
| XLogP | 3.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |