C19H23F3N2O — CID 11610012
N-(2-bicyclo[2.2.1]heptanyl)-N-[(3S)-pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide (PubChem CID 11610012) has the molecular formula C19H23F3N2O and a molecular weight of 352.40 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-N-[(3S)-pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-N-[(3S)-pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11610012 |
| Molecular Formula | C19H23F3N2O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-N-[(3S)-pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(c1ccccc1C(F)(F)F)N(C1CC2CCC1C2)[C@H]1CCNC1 |
| InChI | InChI=1S/C19H23F3N2O/c20-19(21,22)16-4-2-1-3-15(16)18(25)24(14-7-8-23-11-14)17-10-12-5-6-13(17)9-12/h1-4,12-14,17,23H,5-11H2/t12?,13?,14-,17?/m0/s1 |
| InChIKey | DRIWRZYKGWDVJX-XJIRZWNVSA-N |
| XLogP | 3.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |