C19H25F3N2O — CID 11631726
N-cycloheptyl-N-[(3R)-pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide (PubChem CID 11631726) has the molecular formula C19H25F3N2O and a molecular weight of 354.42 g/mol. Its IUPAC name is N-cycloheptyl-N-[(3R)-pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-cycloheptyl-N-[(3R)-pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11631726 |
| Molecular Formula | C19H25F3N2O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-cycloheptyl-N-[(3R)-pyrrolidin-3-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(c1ccccc1C(F)(F)F)N(C1CCCCCC1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C19H25F3N2O/c20-19(21,22)17-10-6-5-9-16(17)18(25)24(15-11-12-23-13-15)14-7-3-1-2-4-8-14/h5-6,9-10,14-15,23H,1-4,7-8,11-13H2/t15-/m1/s1 |
| InChIKey | LCTMCFKGIQCYOO-OAHLLOKOSA-N |
| XLogP | 4.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |