C19H22BFN2O3 — CID 11610087
5-[2-(3-fluoro-4-methoxyphenyl)benzimidazol-1-yl]pentylboronic acid (PubChem CID 11610087) has the molecular formula C19H22BFN2O3 and a molecular weight of 356.21 g/mol. Its IUPAC name is 5-[2-(3-fluoro-4-methoxyphenyl)benzimidazol-1-yl]pentylboronic acid.
| Compound Name | 5-[2-(3-fluoro-4-methoxyphenyl)benzimidazol-1-yl]pentylboronic acid |
|---|---|
| PubChem CID | 11610087 |
| Molecular Formula | C19H22BFN2O3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-[2-(3-fluoro-4-methoxyphenyl)benzimidazol-1-yl]pentylboronic acid |
| SMILES | COc1ccc(-c2nc3ccccc3n2CCCCCB(O)O)cc1F |
| InChI | InChI=1S/C19H22BFN2O3/c1-26-18-10-9-14(13-15(18)21)19-22-16-7-3-4-8-17(16)23(19)12-6-2-5-11-20(24)25/h3-4,7-10,13,24-25H,2,5-6,11-12H2,1H3 |
| InChIKey | QBELEOXLMDSAPF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|