C28H34FN3O2 — CID 175290003
N,N-dicyclohexyl-2-[2-(3-fluoro-4-methoxyphenyl)benzimidazol-1-yl]acetamide (PubChem CID 175290003) has the molecular formula C28H34FN3O2 and a molecular weight of 463.60 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-[2-(3-fluoro-4-methoxyphenyl)benzimidazol-1-yl]acetamide.
| Compound Name | N,N-dicyclohexyl-2-[2-(3-fluoro-4-methoxyphenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 175290003 |
| Molecular Formula | C28H34FN3O2 |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | N,N-dicyclohexyl-2-[2-(3-fluoro-4-methoxyphenyl)benzimidazol-1-yl]acetamide |
| SMILES | COc1ccc(-c2nc3ccccc3n2CC(=O)N(C2CCCCC2)C2CCCCC2)cc1F |
| InChI | InChI=1S/C28H34FN3O2/c1-34-26-17-16-20(18-23(26)29)28-30-24-14-8-9-15-25(24)31(28)19-27(33)32(21-10-4-2-5-11-21)22-12-6-3-7-13-22/h8-9,14-18,21-22H,2-7,10-13,19H2,1H3 |
| InChIKey | RVHCDBPLZYPUGX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |