C29H33F4N3O2 — CID 175290028
N,N-dicyclohexyl-2-[2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]benzimidazol-1-yl]acetamide (PubChem CID 175290028) has the molecular formula C29H33F4N3O2 and a molecular weight of 531.59 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-[2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]benzimidazol-1-yl]acetamide.
| Compound Name | N,N-dicyclohexyl-2-[2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 175290028 |
| Molecular Formula | C29H33F4N3O2 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N,N-dicyclohexyl-2-[2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]benzimidazol-1-yl]acetamide |
| SMILES | O=C(Cn1c(-c2ccccc2OC(F)(F)C(F)F)nc2ccccc21)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C29H33F4N3O2/c30-28(31)29(32,33)38-25-18-10-7-15-22(25)27-34-23-16-8-9-17-24(23)35(27)19-26(37)36(20-11-3-1-4-12-20)21-13-5-2-6-14-21/h7-10,15-18,20-21,28H,1-6,11-14,19H2 |
| InChIKey | TVDZNEYXOBYBKG-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|