C18H19NO5S2 — CID 11610879
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-methyl-2-sulfanylpropanoyl)benzenesulfonamide (PubChem CID 11610879) has the molecular formula C18H19NO5S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-methyl-2-sulfanylpropanoyl)benzenesulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-methyl-2-sulfanylpropanoyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11610879 |
| Molecular Formula | C18H19NO5S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-methyl-2-sulfanylpropanoyl)benzenesulfonamide |
| SMILES | CC(C)(S)C(=O)c1ccc(S(=O)(=O)Nc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C18H19NO5S2/c1-18(2,25)17(20)12-3-6-14(7-4-12)26(21,22)19-13-5-8-15-16(11-13)24-10-9-23-15/h3-8,11,19,25H,9-10H2,1-2H3 |
| InChIKey | YHFJENQIZNDXHG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|